cas: 450412-27-8 — see every product listed under this CAS number, including other names
Ethyl 5-Bromo-2-iodobenzoate, 97% (CAS 450412-27-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F038709-100MG |
| cas | 450412-27-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 96.86 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 388.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 5-bromo-2-iodobenzoate (CAS 450412-27-8) is a chemical compound with the molecular formula C9H8BrIO2 and a molecular weight of 354.97 g/mol. IUPAC name: ethyl 5-bromo-2-iodobenzoate. InChIKey: JWUQSSZXGVRFDZ-UHFFFAOYSA-N.
| Molecular formula | C9H8BrIO2 |
|---|---|
| Molecular weight | 354.97 g/mol |
| IUPAC name | ethyl 5-bromo-2-iodobenzoate |
| InChIKey | JWUQSSZXGVRFDZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)Br)I |
Computed by PubChem (NCBI)