cas: 914347-21-0 — see every product listed under this CAS number, including other names
Ethyl 5-bromo-2-phenylthiazole-4-carboxylate, 98% (CAS 914347-21-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F079720-25G |
| cas | 914347-21-0 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 3845.54 Pln | |
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 1106.92 Pln | |
| Fluorochem | 10g | 1950.37 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 5-bromo-2-phenyl-1,3-thiazole-4-carboxylate (CAS 914347-21-0) is a chemical compound with the molecular formula C12H10BrNO2S and a molecular weight of 312.18 g/mol. IUPAC name: ethyl 5-bromo-2-phenyl-1,3-thiazole-4-carboxylate. InChIKey: ONAJVAODOMRERW-UHFFFAOYSA-N.
| Molecular formula | C12H10BrNO2S |
|---|---|
| Molecular weight | 312.18 g/mol |
| IUPAC name | ethyl 5-bromo-2-phenyl-1,3-thiazole-4-carboxylate |
| InChIKey | ONAJVAODOMRERW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=N1)C2=CC=CC=C2)Br |
Computed by PubChem (NCBI)