cas: 310436-60-3 — see every product listed under this CAS number, including other names
Ethyl 5-ethyl-4-hydroxypyrrolo[1,2-f][1,2,4]triazine-6-carboxylate, 97%, 97% (CAS 310436-60-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1142YX-100mg |
| cas | 310436-60-3 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 500mg | 458.00 Pln | |
| Chemat | 1g | 654.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-ethyl-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate (CAS 310436-60-3) is a chemical compound with the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. IUPAC name: ethyl 5-ethyl-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate. InChIKey: ZCJUMISNPKORHP-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O3 |
|---|---|
| Molecular weight | 235.24 g/mol |
| IUPAC name | ethyl 5-ethyl-4-oxo-3H-pyrrolo[2,1-f][1,2,4]triazine-6-carboxylate |
| InChIKey | ZCJUMISNPKORHP-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=O)NC=NN2C=C1C(=O)OCC |
Computed by PubChem (NCBI)