cas: 32278-52-7 — see every product listed under this CAS number, including other names
Ethyl 5-oxothiazolo[3,2-a]pyridine-6-carboxylate, 98%, 98% (CAS 32278-52-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CKRW-100mg |
| cas | 32278-52-7 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 462.80 Pln | |
| Chemat | 5g | 2061.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (CAS 32278-52-7) is a chemical compound with the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. IUPAC name: ethyl 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate. InChIKey: SEEBZSXGWQRHLB-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O3S |
|---|---|
| Molecular weight | 224.24 g/mol |
| IUPAC name | ethyl 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| InChIKey | SEEBZSXGWQRHLB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2N(C1=O)C=CS2 |
Computed by PubChem (NCBI)