cas: 16691-25-1 — see every product listed under this CAS number, including other names
Ethyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate, 98% (CAS 16691-25-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F214519-250MG |
| cas | 16691-25-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 325.94 Pln | |
| Fluorochem | 2.5g | 737.26 Pln | |
| Fluorochem | 5g | 1101.71 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate (CAS 16691-25-1) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: ethyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate. InChIKey: IHWHTIPPAPNKLN-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | ethyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate |
| InChIKey | IHWHTIPPAPNKLN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN=C(O1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)