cas: 16691-25-1 — see every product listed under this CAS number, including other names
ETHYL 5-PHENYL-1,3,4-OXADIAZOLE-2-CARBOXYLATE, 98%, 98% (CAS 16691-25-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112X1T-100mg |
| cas | 16691-25-1 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 414.80 Pln | |
| Chemat | 5g | 1566.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate (CAS 16691-25-1) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: ethyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate. InChIKey: IHWHTIPPAPNKLN-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | ethyl 5-phenyl-1,3,4-oxadiazole-2-carboxylate |
| InChIKey | IHWHTIPPAPNKLN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN=C(O1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)