Ethyl 6-(tert-butyl)-4-chloronicotinate, 97%
cas: 1416439-99-0 — see every product listed under this CAS number, including other names
Ethyl 6-(tert-butyl)-4-chloronicotinate, 97% (CAS 1416439-99-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A380473-100mg |
| cas | 1416439-99-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 426.00 Pln | |
| Ambeed | 250mg | 665.19 Pln | |
| Ambeed | 1g | 1660.88 Pln | |
| Ambeed | 5g | 5688.12 Pln | |
| BLDpharm | 100mg | 453.20 Pln | |
| BLDpharm | 250mg | 708.66 Pln | |
| BLDpharm | 1g | 1786.06 Pln | |
| BLDpharm | 5g | 6128.98 Pln | |
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 554.00 Pln | |
| Chemat | 1g | 1389.20 Pln | |
| Chemat | 5g | 6482.00 Pln | |
| Fluorochem | 100mg | 638.33 Pln | |
| Fluorochem | 250mg | 1013.20 Pln | |
| Fluorochem | 1g | 2580.36 Pln | |
| Fluorochem | 5g | 11827.10 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Ethyl 6-tert-butyl-4-chloropyridine-3-carboxylate (CAS 1416439-99-0) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: ethyl 6-tert-butyl-4-chloropyridine-3-carboxylate. InChIKey: PINCANJVFNERAF-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | ethyl 6-tert-butyl-4-chloropyridine-3-carboxylate |
| InChIKey | PINCANJVFNERAF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C(C=C1Cl)C(C)(C)C |
Computed by PubChem (NCBI)