cas: 1805421-53-7 — see every product listed under this CAS number, including other names
Ethyl 6-bromo-2-fluoro-3-methylbenzoate, 98% (CAS 1805421-53-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1634593-5g |
| cas | 1805421-53-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 6417.25 Pln | |
| AmBeed | 10g | 10818.01 Pln | |
| AmBeed | 25g | 21227.50 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
Ethyl 6-bromo-2-fluoro-3-methylbenzoate (CAS 1805421-53-7) is a chemical compound with the molecular formula C10H10BrFO2 and a molecular weight of 261.09 g/mol. IUPAC name: ethyl 6-bromo-2-fluoro-3-methylbenzoate. InChIKey: HHQDZKUHBNOEOB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO2 |
|---|---|
| Molecular weight | 261.09 g/mol |
| IUPAC name | ethyl 6-bromo-2-fluoro-3-methylbenzoate |
| InChIKey | HHQDZKUHBNOEOB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1F)C)Br |
Computed by PubChem (NCBI)