cas: 1005209-44-8 — see every product listed under this CAS number, including other names
Ethyl 6-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate, 97% (CAS 1005209-44-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228158-100MG |
| cas | 1005209-44-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 768.50 Pln | |
| Fluorochem | 500mg | 1231.88 Pln | |
| Fluorochem | 1g | 1997.23 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 6-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate (CAS 1005209-44-8) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: ethyl 6-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate. InChIKey: HDRIBFRDDYKHAP-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | ethyl 6-chloropyrazolo[1,5-a]pyrimidine-2-carboxylate |
| InChIKey | HDRIBFRDDYKHAP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NN2C=C(C=NC2=C1)Cl |
Computed by PubChem (NCBI)