cas: 26892-92-2 — see every product listed under this CAS number, including other names
Ethyl 6-cyano-4-oxo-1,4-dihydroquinoline-3-carboxylate 97% (CAS 26892-92-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A196333-10g |
| cas | 26892-92-2 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 8741.94 Pln | |
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1432.81 Pln | |
| Ambeed | 5g | 4837.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A196333 |
Ethyl 6-cyano-4-oxo-1H-quinoline-3-carboxylate (CAS 26892-92-2) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: ethyl 6-cyano-4-oxo-1H-quinoline-3-carboxylate. InChIKey: DRNLVFZCTWSAOW-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | ethyl 6-cyano-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | DRNLVFZCTWSAOW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=C(C=C2)C#N |
Computed by PubChem (NCBI)