CAS 4771-08-8 appears in our catalog under these names: 3'-Nitrobenzanilide, 98%, N-(3-Nitrophenyl)benzamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
N-(3-nitrophenyl)benzamide (CAS 4771-08-8) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: N-(3-nitrophenyl)benzamide. InChIKey: WLUMOMGZPNOSOG-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | N-(3-nitrophenyl)benzamide |
| InChIKey | WLUMOMGZPNOSOG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)