CAS 26892-92-2 appears in our catalog under these names: 6-Cyano-4-hydroxy-quinoline-3-carboxylic acid ethyl ester, 95%, 6-Cyano-4-oxo-1,4-dihydro-quinoline-3-carboxylic acid ethyl ester, 95%, Ethyl 6-cyano-4-oxo-1,4-dihydroquinoline-3-carboxylate 97%, 6-Cyano-4-hydroxy-quinoline-3-carboxylic acid ethyl ester, 97%, 97%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
Ethyl 6-cyano-4-oxo-1H-quinoline-3-carboxylate (CAS 26892-92-2) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: ethyl 6-cyano-4-oxo-1H-quinoline-3-carboxylate. InChIKey: DRNLVFZCTWSAOW-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | ethyl 6-cyano-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | DRNLVFZCTWSAOW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=C(C=C2)C#N |
Computed by PubChem (NCBI)