Products 72733-84-7
CAS 72733-84-7 appears in our catalog under these names: 3-[(Pyridin-3-ylcarbonyl)amino]benzoic acid, 95%, 3-(Nicotinamido)benzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(pyridine-3-carbonylamino)benzoic acid (CAS 72733-84-7) is a chemical compound with the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. IUPAC name: 3-(pyridine-3-carbonylamino)benzoic acid. InChIKey: ZPXHGRCNSBEEOL-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O3 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 3-(pyridine-3-carbonylamino)benzoic acid |
| InChIKey | ZPXHGRCNSBEEOL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=CN=CC=C2)C(=O)O |
Computed by PubChem (NCBI)