cas: 220120-59-2 — see every product listed under this CAS number, including other names
Ethyl 6-fluoro-3,4-dihydro-2H-benzo[b][1,4]oxazine-2-carboxylate, 98%, 98% (CAS 220120-59-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118Q8L-100mg |
| cas | 220120-59-2 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1091.60 Pln | |
| Chemat | 250mg | 1686.80 Pln | |
| Chemat | 500mg | 2651.60 Pln | |
| Chemat | 1g | 4312.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Ethyl 6-fluoro-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate (CAS 220120-59-2) is a chemical compound with the molecular formula C11H12FNO3 and a molecular weight of 225.22 g/mol. IUPAC name: ethyl 6-fluoro-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate. InChIKey: NHOMLOLSDHZKLL-UHFFFAOYSA-N.
| Molecular formula | C11H12FNO3 |
|---|---|
| Molecular weight | 225.22 g/mol |
| IUPAC name | ethyl 6-fluoro-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylate |
| InChIKey | NHOMLOLSDHZKLL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CNC2=C(O1)C=CC(=C2)F |
Computed by PubChem (NCBI)