cas: 175087-43-1 — see every product listed under this CAS number, including other names
Ethyl 6-nitro-4-oxo-1,4-dihydroquinoline-3-carboxylate, 95% (CAS 175087-43-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F549739-100MG |
| cas | 175087-43-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 247.85 Pln | |
| Fluorochem | 250mg | 450.90 Pln | |
| Fluorochem | 1g | 581.06 Pln | |
| Fluorochem | 5g | 1632.78 Pln | |
| Fluorochem | 10g | 2694.90 Pln | |
| Fluorochem | 25g | 6266.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 6-nitro-4-oxo-1H-quinoline-3-carboxylate (CAS 175087-43-1) is a chemical compound with the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. IUPAC name: ethyl 6-nitro-4-oxo-1H-quinoline-3-carboxylate. InChIKey: DBJCDCSZGDONQQ-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O5 |
|---|---|
| Molecular weight | 262.22 g/mol |
| IUPAC name | ethyl 6-nitro-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | DBJCDCSZGDONQQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)