CAS 91974-32-2 appears in our catalog under these names: Ethyl 2-(6-nitro-3-indolyl)-2-oxoacetate, 95%, ethyl 2-(6-nitro-1H-indol-3-yl)-2-oxoacetate. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 250mg, 1g, 500mg.
Ethyl 2-(6-nitro-1H-indol-3-yl)-2-oxoacetate (CAS 91974-32-2) is a chemical compound with the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. IUPAC name: ethyl 2-(6-nitro-1H-indol-3-yl)-2-oxoacetate. InChIKey: WBUKNGHHRBTHAF-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O5 |
|---|---|
| Molecular weight | 262.22 g/mol |
| IUPAC name | ethyl 2-(6-nitro-1H-indol-3-yl)-2-oxoacetate |
| InChIKey | WBUKNGHHRBTHAF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CNC2=C1C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)