CAS 159670-70-9 appears in our catalog under these names: Ethyl 5-(4-nitrophenyl)isoxazole-3-carboxylate, 97%, 3-(4-Nitro-phenyl)-isoxazole-5-carboxylic acid ethylester, 98%, 98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg, 1g.
Ethyl 5-(4-nitrophenyl)-1,2-oxazole-3-carboxylate (CAS 159670-70-9) is a chemical compound with the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. IUPAC name: ethyl 5-(4-nitrophenyl)-1,2-oxazole-3-carboxylate. InChIKey: GOCOARSXHUWDGZ-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O5 |
|---|---|
| Molecular weight | 262.22 g/mol |
| IUPAC name | ethyl 5-(4-nitrophenyl)-1,2-oxazole-3-carboxylate |
| InChIKey | GOCOARSXHUWDGZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NOC(=C1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)