CAS 884982-97-2 is the registry number for Ethyl 3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazole-5-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazole-5-carboxylate (CAS 884982-97-2) is a chemical compound with the molecular formula C12H10N2O5 and a molecular weight of 262.22 g/mol. IUPAC name: ethyl 3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazole-5-carboxylate. InChIKey: JKWFXOBNHJWNDH-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O5 |
|---|---|
| Molecular weight | 262.22 g/mol |
| IUPAC name | ethyl 3-(1,3-benzodioxol-5-yl)-1,2,4-oxadiazole-5-carboxylate |
| InChIKey | JKWFXOBNHJWNDH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NO1)C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)