cas: 100478-04-4 — see every product listed under this CAS number, including other names
Ethyl 7-chloro-1H-pyrazolo[4,3-b]pyridine-6-carboxylate, 97%, 97% (CAS 100478-04-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111341-100mg |
| cas | 100478-04-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 1029.20 Pln | |
| Chemat | 500mg | 1672.40 Pln | |
| Chemat | 1g | 2742.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 7-chloro-1H-pyrazolo[4,3-b]pyridine-6-carboxylate (CAS 100478-04-4) is a chemical compound with the molecular formula C9H8ClN3O2 and a molecular weight of 225.63 g/mol. IUPAC name: ethyl 7-chloro-1H-pyrazolo[4,3-b]pyridine-6-carboxylate. InChIKey: XIHDSBGJZZFOSZ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3O2 |
|---|---|
| Molecular weight | 225.63 g/mol |
| IUPAC name | ethyl 7-chloro-1H-pyrazolo[4,3-b]pyridine-6-carboxylate |
| InChIKey | XIHDSBGJZZFOSZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C=NNC2=C1Cl |
Computed by PubChem (NCBI)