cas: 69555-14-2 — see every product listed under this CAS number, including other names
Ethyl N-(diphenylmethylene)glycinate, 95% (CAS 69555-14-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F019212-5G |
| cas | 69555-14-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 91.65 Pln | |
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 185.37 Pln | |
| Fluorochem | 500g | 643.54 Pln | |
| Fluorochem | 1kg | 1237.08 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-(benzhydrylideneamino)acetate (CAS 69555-14-2) is a chemical compound with the molecular formula C17H17NO2 and a molecular weight of 267.32 g/mol. IUPAC name: ethyl 2-(benzhydrylideneamino)acetate. InChIKey: QUGJYNGNUBHTNS-UHFFFAOYSA-N.
| Molecular formula | C17H17NO2 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | ethyl 2-(benzhydrylideneamino)acetate |
| InChIKey | QUGJYNGNUBHTNS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN=C(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)