cas: 69555-14-2 — see every product listed under this CAS number, including other names
N-(DiphenylMethylene)-Gly-OEt 95% (CAS 69555-14-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A126045-5g |
| cas | 69555-14-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 197.94 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 292.50 Pln | |
| Ambeed | 500g | 859.88 Pln | |
| Ambeed | 1000g | 1638.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A126045 |
Ethyl 2-(benzhydrylideneamino)acetate (CAS 69555-14-2) is a chemical compound with the molecular formula C17H17NO2 and a molecular weight of 267.32 g/mol. IUPAC name: ethyl 2-(benzhydrylideneamino)acetate. InChIKey: QUGJYNGNUBHTNS-UHFFFAOYSA-N.
| Molecular formula | C17H17NO2 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | ethyl 2-(benzhydrylideneamino)acetate |
| InChIKey | QUGJYNGNUBHTNS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN=C(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)