cas: 69555-14-2 — see every product listed under this CAS number, including other names
N-(Diphenylmethylene)glycine Ethyl Ester, >97.0%(T) (CAS 69555-14-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D3833-5G |
| cas | 69555-14-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 98.68 Pln | |
| TCI | 25g | 251.11 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(T) |
Ethyl 2-(benzhydrylideneamino)acetate (CAS 69555-14-2) is a chemical compound with the molecular formula C17H17NO2 and a molecular weight of 267.32 g/mol. IUPAC name: ethyl 2-(benzhydrylideneamino)acetate. InChIKey: QUGJYNGNUBHTNS-UHFFFAOYSA-N.
| Molecular formula | C17H17NO2 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | ethyl 2-(benzhydrylideneamino)acetate |
| InChIKey | QUGJYNGNUBHTNS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN=C(C1=CC=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)