cas: 64951-06-0 — see every product listed under this CAS number, including other names
Ethyl imidazo[1,2-a]pyrimidine-2-carboxylate 97% (CAS 64951-06-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A109139-100mg |
| cas | 64951-06-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 225.75 Pln | |
| Ambeed | 5g | 515.00 Pln | |
| Ambeed | 25g | 1616.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A109139 |
Ethyl imidazo[1,2-a]pyrimidine-2-carboxylate (CAS 64951-06-0) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: ethyl imidazo[1,2-a]pyrimidine-2-carboxylate. InChIKey: SORASSFGEFQWIH-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | ethyl imidazo[1,2-a]pyrimidine-2-carboxylate |
| InChIKey | SORASSFGEFQWIH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C=CC=NC2=N1 |
Computed by PubChem (NCBI)