cas: 64951-06-0 — see every product listed under this CAS number, including other names
Imidazo[1,2-a]pyrimidine-2-carboxylic acid, ethyl ester, 97%, 97% (CAS 64951-06-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QFF-100mg |
| cas | 64951-06-0 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 410.00 Pln | |
| Chemat | 10g | 741.20 Pln | |
| Chemat | 25g | 1307.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl imidazo[1,2-a]pyrimidine-2-carboxylate (CAS 64951-06-0) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: ethyl imidazo[1,2-a]pyrimidine-2-carboxylate. InChIKey: SORASSFGEFQWIH-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | ethyl imidazo[1,2-a]pyrimidine-2-carboxylate |
| InChIKey | SORASSFGEFQWIH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN2C=CC=NC2=N1 |
Computed by PubChem (NCBI)