cas: 3753-05-7 — see every product listed under this CAS number, including other names
Ethylene Glycol Bis(4-carboxyphenyl) Ether, >95.0%(T) (CAS 3753-05-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | E0415-1G |
| cas | 3753-05-7 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 659.24 Pln | |
| TCI | 5g | 3024.44 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(T) |
4-[2-(4-carboxyphenoxy)ethoxy]benzoic acid (CAS 3753-05-7) is a chemical compound with the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. IUPAC name: 4-[2-(4-carboxyphenoxy)ethoxy]benzoic acid. InChIKey: VAXBLYWAVAIJJJ-UHFFFAOYSA-N.
| Molecular formula | C16H14O6 |
|---|---|
| Molecular weight | 302.28 g/mol |
| IUPAC name | 4-[2-(4-carboxyphenoxy)ethoxy]benzoic acid |
| InChIKey | VAXBLYWAVAIJJJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)OCCOC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)