cas: 41340-36-7 — see every product listed under this CAS number, including other names
Etodolac impurity H 98% (CAS 41340-36-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A368253-5g |
| cas | 41340-36-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 214.62 Pln | |
| Ambeed | 100g | 542.81 Pln | |
| Ambeed | 500g | 1744.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A368253 |
2-(7-ethyl-1H-indol-3-yl)ethanol (CAS 41340-36-7) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: 2-(7-ethyl-1H-indol-3-yl)ethanol. InChIKey: UVSDNCAZVSQJQA-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | 2-(7-ethyl-1H-indol-3-yl)ethanol |
| InChIKey | UVSDNCAZVSQJQA-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC=C1)C(=CN2)CCO |
Computed by PubChem (NCBI)