cas: 26400-33-9 — see every product listed under this CAS number, including other names
FA-Gly-Leu-NH2, 99.51% (CAS 26400-33-9) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 50 mg, 10mM/1mL, 25 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-137303-100 mg |
| cas | 26400-33-9 |
| size | 100 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 909.48 Pln | |
| MedChemExpress | 50 mg | 612.26 Pln | |
| MedChemExpress | 10mM/1mL | 459.01 Pln | |
| MedChemExpress | 25 mg | 431.15 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.51% |
(2S)-2-[[2-[3-(furan-2-yl)prop-2-enoylamino]acetyl]amino]-4-methylpentanamide (CAS 26400-33-9) is a chemical compound with the molecular formula C15H21N3O4 and a molecular weight of 307.34 g/mol. IUPAC name: (2S)-2-[[2-[3-(furan-2-yl)prop-2-enoylamino]acetyl]amino]-4-methylpentanamide. InChIKey: JRGRHYPAYAJGAF-LBPRGKRZSA-N.
| Molecular formula | C15H21N3O4 |
|---|---|
| Molecular weight | 307.34 g/mol |
| IUPAC name | (2S)-2-[[2-[3-(furan-2-yl)prop-2-enoylamino]acetyl]amino]-4-methylpentanamide |
| InChIKey | JRGRHYPAYAJGAF-LBPRGKRZSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N)NC(=O)CNC(=O)C=CC1=CC=CO1 |
Computed by PubChem (NCBI)