CAS 2417298-29-2 appears in our catalog under these names: FC-116/ 98.18% (existing batch purity), FC–116, FC-116 98%, FC-116, FC-116, 98.04%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
(E)-3-(6-fluoro-1H-indol-3-yl)-2-methyl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (CAS 2417298-29-2) is a chemical compound with the molecular formula C21H20FNO4 and a molecular weight of 369.4 g/mol. IUPAC name: (E)-3-(6-fluoro-1H-indol-3-yl)-2-methyl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one. InChIKey: HGVNKQONHGKNOE-KPKJPENVSA-N.
| Molecular formula | C21H20FNO4 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (E)-3-(6-fluoro-1H-indol-3-yl)-2-methyl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| InChIKey | HGVNKQONHGKNOE-KPKJPENVSA-N |
| SMILES | C/C(=C\C1=CNC2=C1C=CC(=C2)F)/C(=O)C3=CC(=C(C(=C3)OC)OC)OC |
Computed by PubChem (NCBI)