cas: 87720-55-6 — see every product listed under this CAS number, including other names
FMOC-4,5-DEHYDRO-LEU-OH, 98% (CAS 87720-55-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F475447-250MG |
| cas | 87720-55-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 601.89 Pln | |
| Fluorochem | 5g | 2653.25 Pln | |
| Fluorochem | 10g | 5246.09 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpent-4-enoic acid (CAS 87720-55-6) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpent-4-enoic acid. InChIKey: YUPPKUMKKSBZRL-IBGZPJMESA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpent-4-enoic acid |
| InChIKey | YUPPKUMKKSBZRL-IBGZPJMESA-N |
| SMILES | CC(=C)C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)