CAS 87720-55-6 appears in our catalog under these names: Fmoc-4,5-dehydro-l-leucine, 97%, Fmoc–4,5–dehydro–Leu–OH, Fmoc-4,5-dehydro-L-leucine, (2S)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-methyl-4-pentenoic acid, 98%, 98%, FMOC-4,5-DEHYDRO-LEU-OH, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpent-4-enoic acid (CAS 87720-55-6) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpent-4-enoic acid. InChIKey: YUPPKUMKKSBZRL-IBGZPJMESA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpent-4-enoic acid |
| InChIKey | YUPPKUMKKSBZRL-IBGZPJMESA-N |
| SMILES | CC(=C)C[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)