CAS 31008-19-2 appears in our catalog under these names: Fargesin, Fargesin/ 99.82% (existing batch purity), Fargesin, >98.0%(HPLC), Fargesin 98%, (±)-Fargesin, 97%, 97%. Offered by: GLPBio, TargetMol, Biosynth, TCI, Ambeed. Available pack sizes: 20mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 250mg.
5-[(3S,3aR,6R,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-1,3-benzodioxole (CAS 31008-19-2) is a chemical compound with the molecular formula C21H22O6 and a molecular weight of 370.4 g/mol. IUPAC name: 5-[(3S,3aR,6R,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-1,3-benzodioxole. InChIKey: AWOGQCSIVCQXBT-LATRNWQMSA-N.
| Molecular formula | C21H22O6 |
|---|---|
| Molecular weight | 370.4 g/mol |
| IUPAC name | 5-[(3S,3aR,6R,6aR)-6-(3,4-dimethoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-3-yl]-1,3-benzodioxole |
| InChIKey | AWOGQCSIVCQXBT-LATRNWQMSA-N |
| SMILES | COC1=C(C=C(C=C1)[C@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC5=C(C=C4)OCO5)OC |
Computed by PubChem (NCBI)