Fmoc-(Dmb)Ala-OH 95%
cas: 1425938-66-4 — see every product listed under this CAS number, including other names
Fmoc-(Dmb)Ala-OH 95% (CAS 1425938-66-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A750051-100mg |
| cas | 1425938-66-4 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 681.88 Pln | |
| Ambeed | 5g | 2183.75 Pln | |
| Ambeed | 10g | 3769.06 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A750051 |
(2S)-2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid (CAS 1425938-66-4) is a chemical compound with the molecular formula C27H27NO6 and a molecular weight of 461.5 g/mol. IUPAC name: (2S)-2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid. InChIKey: BTEPUGBDZZZLCU-KRWDZBQOSA-N.
| Molecular formula | C27H27NO6 |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | (2S)-2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
| InChIKey | BTEPUGBDZZZLCU-KRWDZBQOSA-N |
| SMILES | C[C@@H](C(=O)O)N(CC1=C(C=C(C=C1)OC)OC)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)