cas: 1425938-66-4 — see every product listed under this CAS number, including other names
L-Alanine, N-[(2,4-dimethoxyphenyl)methyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-, 95%, 95% (CAS 1425938-66-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110Z7A-100mg |
| cas | 1425938-66-4 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 232.40 Pln | |
| Chemat | 1g | 534.80 Pln | |
| Chemat | 5g | 1686.80 Pln | |
| Chemat | 10g | 2896.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid (CAS 1425938-66-4) is a chemical compound with the molecular formula C27H27NO6 and a molecular weight of 461.5 g/mol. IUPAC name: (2S)-2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid. InChIKey: BTEPUGBDZZZLCU-KRWDZBQOSA-N.
| Molecular formula | C27H27NO6 |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | (2S)-2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
| InChIKey | BTEPUGBDZZZLCU-KRWDZBQOSA-N |
| SMILES | C[C@@H](C(=O)O)N(CC1=C(C=C(C=C1)OC)OC)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)