cas: 1425938-66-4 — see every product listed under this CAS number, including other names
N-(((9H-fluoren-9-yl)methoxy)carbonyl)-N-(2,4-dimethoxybenzyl)-L-alanine, 95% (CAS 1425938-66-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F727827-100MG |
| cas | 1425938-66-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 857.01 Pln | |
| Fluorochem | 5g | 2762.59 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2S)-2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid (CAS 1425938-66-4) is a chemical compound with the molecular formula C27H27NO6 and a molecular weight of 461.5 g/mol. IUPAC name: (2S)-2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid. InChIKey: BTEPUGBDZZZLCU-KRWDZBQOSA-N.
| Molecular formula | C27H27NO6 |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | (2S)-2-[(2,4-dimethoxyphenyl)methyl-(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
| InChIKey | BTEPUGBDZZZLCU-KRWDZBQOSA-N |
| SMILES | C[C@@H](C(=O)O)N(CC1=C(C=C(C=C1)OC)OC)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)