CAS 312965-05-2 appears in our catalog under these names: Fmoc-1,3-cis-ACHC-OH, FMOC-CIS-3-AMINOCYCLOHEXANE CARBOXYLIC ACID, 95% (cis), 95% (cis), Fmoc-1,3-cis-Achc-OH, 95% (cis). Offered by: Iris Biotech, Chemat, Ambeed. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg.
Cis-(1S,3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 312965-05-2) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: cis-(1S,3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: JSVAQZVOHKGTJY-LSDHHAIUSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | cis-(1S,3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | JSVAQZVOHKGTJY-LSDHHAIUSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)