Products 1552171-24-0

CAS 1552171-24-0 is the registry number for 1-(9H-Fluoren-9-ylmethyl) 3-methyl piperidine-1,3-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

1-O-(9H-fluoren-9-ylmethyl) 3-O-methyl piperidine-1,3-dicarboxylate (CAS 1552171-24-0) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: 1-O-(9H-fluoren-9-ylmethyl) 3-O-methyl piperidine-1,3-dicarboxylate. InChIKey: NPUZHUZJPQJENA-UHFFFAOYSA-N.

Identity
Molecular formulaC22H23NO4
Molecular weight365.4 g/mol
IUPAC name1-O-(9H-fluoren-9-ylmethyl) 3-O-methyl piperidine-1,3-dicarboxylate
InChIKeyNPUZHUZJPQJENA-UHFFFAOYSA-N
SMILESCOC(=O)C1CCCN(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)