CAS 917099-03-7 appears in our catalog under these names: Fmoc-cis-3-aminocyclohexane-1-carboxylic acid, 95%, rac-(1R,3S)-3-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)cyclohexane-1-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 25g, 1g, 0,5g.
Cis-(1R,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 917099-03-7) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: cis-(1R,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: JSVAQZVOHKGTJY-CABCVRRESA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | cis-(1R,3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | JSVAQZVOHKGTJY-CABCVRRESA-N |
| SMILES | C1C[C@H](C[C@H](C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)