CAS 162648-54-6 appears in our catalog under these names: 1-(Fmoc-amino)cyclohexanecarboxylic acid, 98%, Fmoc–Ac6c–OH, 1-(Fmoc-amino)cyclohexanecarboxylic acid, 98+% , Fmoc-Ac6c-OH 98%, 1-[(Fmoc)amino]cyclohexanecarboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat. Available pack sizes: 1g, 10g, 25g, 100g, 5g, 250mg, 100mg, 50g.
1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid (CAS 162648-54-6) is a chemical compound with the molecular formula C22H23NO4 and a molecular weight of 365.4 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid. InChIKey: VCIVAWBKUQJNSX-UHFFFAOYSA-N.
| Molecular formula | C22H23NO4 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonylamino)cyclohexane-1-carboxylic acid |
| InChIKey | VCIVAWBKUQJNSX-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)