cas: 185379-40-2 — see every product listed under this CAS number, including other names
Fmoc-2-Pal-OH, 98%, 98% (CAS 185379-40-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I2JT-250mg |
| cas | 185379-40-2 |
| size | 250mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 165.20 Pln | |
| Chemat | 5g | 438.80 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1576.40 Pln | |
| Chemat | 50g | 2958.80 Pln | |
| Chemat | 100g | 5574.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyridin-2-ylpropanoic acid (CAS 185379-40-2) is a chemical compound with the molecular formula C23H20N2O4 and a molecular weight of 388.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyridin-2-ylpropanoic acid. InChIKey: DXIVJCDZOMUITR-NRFANRHFSA-N.
| Molecular formula | C23H20N2O4 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyridin-2-ylpropanoic acid |
| InChIKey | DXIVJCDZOMUITR-NRFANRHFSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=CC=N4)C(=O)O |
Computed by PubChem (NCBI)