CAS 1788861-35-7 appears in our catalog under these names: 3-(Fmoc-amino)-4-(methylamino)benzoic acid, 95%, Fmoc-MeDbz-OH, Fmoc-MeDbz, Fmoc-MeDbz-OH 98%, 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-(methylamino)benzoic acid, 98%, 98%. Offered by: Combi-blocks, Iris Biotech, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 5g, 1g, 250mg, 25g, 500mg.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(methylamino)benzoic acid (CAS 1788861-35-7) is a chemical compound with the molecular formula C23H20N2O4 and a molecular weight of 388.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(methylamino)benzoic acid. InChIKey: YIRHQVZRKURGRG-UHFFFAOYSA-N.
| Molecular formula | C23H20N2O4 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(methylamino)benzoic acid |
| InChIKey | YIRHQVZRKURGRG-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)