CAS 142994-45-4 appears in our catalog under these names: Fmoc-d-3-pyridylalanine, >95% (HPLC), Fmoc–D–Ala(3–pyridyl)–OH?HCl, Fmoc-D-3Pal-OH, Fmoc-3-(3'-pyridyl)-D-alanine, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-(3-pyridyl)-D-alanine, >98.0%(HPLC). Offered by: TRC, GLPBio, Iris Biotech, Biosynth, TCI. Available pack sizes: 100mg, 250mg, 500mg, 10g, 25g, 5g, 1g, 100g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyridin-3-ylpropanoic acid (CAS 142994-45-4) is a chemical compound with the molecular formula C23H20N2O4 and a molecular weight of 388.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyridin-3-ylpropanoic acid. InChIKey: JQLPMTXRCLXOJO-OAQYLSRUSA-N.
| Molecular formula | C23H20N2O4 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyridin-3-ylpropanoic acid |
| InChIKey | JQLPMTXRCLXOJO-OAQYLSRUSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CN=CC=C4)C(=O)O |
Computed by PubChem (NCBI)