CAS 746672-87-7 appears in our catalog under these names: Fmoc-dl-4-pyridylalanine, 95%, Fmoc-DL-4-pyridylalanine, Fmoc-DL-3-(4-Pyridyl)-Ala-OH 95%, Fmoc-DL-3-(4-Pyridyl)alanine, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 5g, 10g, 250mg, 1g, 2,5g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyridin-4-ylpropanoic acid (CAS 746672-87-7) is a chemical compound with the molecular formula C23H20N2O4 and a molecular weight of 388.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyridin-4-ylpropanoic acid. InChIKey: SCSSXJVRZMQUKA-UHFFFAOYSA-N.
| Molecular formula | C23H20N2O4 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-pyridin-4-ylpropanoic acid |
| InChIKey | SCSSXJVRZMQUKA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CC=NC=C4)C(=O)O |
Computed by PubChem (NCBI)