cas: 130309-35-2 — see every product listed under this CAS number, including other names
Fmoc-3-Ala(2-thienyl)-OH 95% (CAS 130309-35-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A144819-250mg |
| cas | 130309-35-2 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 164.56 Pln | |
| Ambeed | 5g | 387.06 Pln | |
| Ambeed | 10g | 698.56 Pln | |
| Ambeed | 25g | 1638.62 Pln | |
| Ambeed | 100g | 5237.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A144819 |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid (CAS 130309-35-2) is a chemical compound with the molecular formula C22H19NO4S and a molecular weight of 393.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid. InChIKey: PXBMQFMUHRNKTG-FQEVSTJZSA-N.
| Molecular formula | C22H19NO4S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-thiophen-2-ylpropanoic acid |
| InChIKey | PXBMQFMUHRNKTG-FQEVSTJZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=CS4)C(=O)O |
Computed by PubChem (NCBI)