CAS 917099-00-4 appears in our catalog under these names: (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-methylpent-4-enoic acid, 98%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-methylpent-4-enoic acid, 95%, 95%, Fmoc-4,5-dehydro-d-leu-oh, 95%, Fmoc–4,5–dehydro–D–Leucine. Offered by: AmBeed, Chemat, Combi-blocks, GLPBio. Available pack sizes: 5g, 100mg, 250mg, 1g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpent-4-enoic acid (CAS 917099-00-4) is a chemical compound with the molecular formula C21H21NO4 and a molecular weight of 351.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpent-4-enoic acid. InChIKey: YUPPKUMKKSBZRL-LJQANCHMSA-N.
| Molecular formula | C21H21NO4 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpent-4-enoic acid |
| InChIKey | YUPPKUMKKSBZRL-LJQANCHMSA-N |
| SMILES | CC(=C)C[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)