cas: 1223105-44-9 — see every product listed under this CAS number, including other names
Fmoc-4-(4-methoxyphenyl)-L-phenylalanine, 97%, 97% (CAS 1223105-44-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JMFO-100mg |
| cas | 1223105-44-9 |
| size | 100mg |
| availability | 0.9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 736.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(4-methoxyphenyl)phenyl]propanoic acid (CAS 1223105-44-9) is a chemical compound with the molecular formula C31H27NO5 and a molecular weight of 493.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(4-methoxyphenyl)phenyl]propanoic acid. InChIKey: ZLGMTYBMTLVUJD-LJAQVGFWSA-N.
| Molecular formula | C31H27NO5 |
|---|---|
| Molecular weight | 493.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-(4-methoxyphenyl)phenyl]propanoic acid |
| InChIKey | ZLGMTYBMTLVUJD-LJAQVGFWSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)