CAS 82911-77-1 appears in our catalog under these names: N-Fmoc-L-tyrosine Benzyl Ester, >95% (HPLC), Fmoc–Tyr–Obzl, Fmoc-L-Tyr-OBzl 95%. Offered by: TRC, GLPBio, Ambeed. Available pack sizes: 500mg, 50mg, 100mg, 1g, 5g, 10g, 25g.
Benzyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxyphenyl)propanoate (CAS 82911-77-1) is a chemical compound with the molecular formula C31H27NO5 and a molecular weight of 493.5 g/mol. IUPAC name: benzyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxyphenyl)propanoate. InChIKey: XOPVFGBPEVOJEV-LJAQVGFWSA-N.
| Molecular formula | C31H27NO5 |
|---|---|
| Molecular weight | 493.5 g/mol |
| IUPAC name | benzyl (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-hydroxyphenyl)propanoate |
| InChIKey | XOPVFGBPEVOJEV-LJAQVGFWSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CC2=CC=C(C=C2)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)