CAS 138775-48-1 appears in our catalog under these names: Fmoc-D-Tyr(Bzl)-OH, 97%, Fmoc-D-Tyr(Bzl)-OH, Fmoc-D-Tyr(Bzl)-OH 98%, Fmoc-D-Tyr(Bzl)-OH, 98%, 98%, D-Tyrosine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-O-(phenylmethyl)-, 98%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 100g, 5g, 10g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid (CAS 138775-48-1) is a chemical compound with the molecular formula C31H27NO5 and a molecular weight of 493.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: REHSJSKPWIOKIJ-GDLZYMKVSA-N.
| Molecular formula | C31H27NO5 |
|---|---|
| Molecular weight | 493.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenylmethoxyphenyl)propanoic acid |
| InChIKey | REHSJSKPWIOKIJ-GDLZYMKVSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C[C@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)