CAS 2015382-73-5 is the registry number for Fmoc-L-Phe(3-OBzl)-OH. Offered by: Iris Biotech. Available pack sizes: 1g, 250mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-phenylmethoxyphenyl)propanoic acid (CAS 2015382-73-5) is a chemical compound with the molecular formula C31H27NO5 and a molecular weight of 493.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-phenylmethoxyphenyl)propanoic acid. InChIKey: GQPZYXGVHWAKCX-LJAQVGFWSA-N.
| Molecular formula | C31H27NO5 |
|---|---|
| Molecular weight | 493.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(3-phenylmethoxyphenyl)propanoic acid |
| InChIKey | GQPZYXGVHWAKCX-LJAQVGFWSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)C[C@@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)