cas: 126631-93-4 — see every product listed under this CAS number, including other names
Fmoc-8-Aoc-OH, 97% (CAS 126631-93-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A264170-250mg |
| cas | 126631-93-4 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 348.12 Pln | |
| Ambeed | 25g | 1176.94 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 208.84 Pln | |
| BLDpharm | 5g | 369.89 Pln | |
| BLDpharm | 25g | 1264.02 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
8-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid (CAS 126631-93-4) is a chemical compound with the molecular formula C23H27NO4 and a molecular weight of 381.5 g/mol. IUPAC name: 8-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid. InChIKey: QZQXRZXYWVQWAY-UHFFFAOYSA-N.
| Molecular formula | C23H27NO4 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | 8-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid |
| InChIKey | QZQXRZXYWVQWAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCCCCC(=O)O |
Computed by PubChem (NCBI)