CAS 126631-93-4 appears in our catalog under these names: N-Fmoc-8-Aminooctanoic acid, Fmoc–8–aminooctanoic acid, Fmoc-8-Aoc-OH, Fmoc-8-Aoc-OH 97%, FMOC-8-AOC-OH, >=98.0% HPLC. Offered by: Dr. Ehrenstorfer, GLPBio, Iris Biotech, Ambeed, Sigma-Aldrich. Available pack sizes: 50mg, 1g, 5g, 25g, 250mg, 500MG, 10g, 25 g.
8-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid (CAS 126631-93-4) is a chemical compound with the molecular formula C23H27NO4 and a molecular weight of 381.5 g/mol. IUPAC name: 8-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid. InChIKey: QZQXRZXYWVQWAY-UHFFFAOYSA-N.
| Molecular formula | C23H27NO4 |
|---|---|
| Molecular weight | 381.5 g/mol |
| IUPAC name | 8-(9H-fluoren-9-ylmethoxycarbonylamino)octanoic acid |
| InChIKey | QZQXRZXYWVQWAY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCCCCCCC(=O)O |
Computed by PubChem (NCBI)